About fluoroethene;methyl(diphenyl)silane
fluoroethene;methyl(diphenyl)silane (PubChem CID 174996165) has the molecular formula C15H17FSi
and a molecular weight of 244.38 g/mol. Its IUPAC name is fluoroethene;methyl(diphenyl)silane.
Molecular Properties
| Compound Name | fluoroethene;methyl(diphenyl)silane |
| PubChem CID | 174996165 |
| Molecular Formula | C15H17FSi |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.11 |
| IUPAC Name | fluoroethene;methyl(diphenyl)silane |
| SMILES | C=CF.C[SiH](c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C13H14Si.C2H3F/c1-14(12-8-4-2-5-9-12)13-10-6-3-7-11-13;1-2-3/h2-11,14H,1H3;2H,1H2 |
| InChIKey | WUXCKXYAPHXVKS-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze fluoroethene;methyl(diphenyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of fluoroethene;methyl(diphenyl)silane?
The IUPAC name of fluoroethene;methyl(diphenyl)silane (CID 174996165) is fluoroethene;methyl(diphenyl)silane.
What is the SMILES notation for fluoroethene;methyl(diphenyl)silane?
The canonical SMILES for fluoroethene;methyl(diphenyl)silane is C=CF.C[SiH](c1ccccc1)c1ccccc1.
What is the InChIKey of fluoroethene;methyl(diphenyl)silane?
The InChIKey is WUXCKXYAPHXVKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14Si.C2H3F/c1-14(12-8-4-2-5-9-12)13-10-6-3-7-11-13;1-2-3/h2-11,14H,1H3;2H,1H2.
What are the key properties of fluoroethene;methyl(diphenyl)silane?
fluoroethene;methyl(diphenyl)silane has a molecular weight of 244.38 g/mol, XLogP of 2.76, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for fluoroethene;methyl(diphenyl)silane is sourced from PubChem (CID 174996165), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).