About bis(hydroxy(trimethyl)silane);methyl(diphenyl)silane;bis(trimethylsilane)
bis(hydroxy(trimethyl)silane);methyl(diphenyl)silane;bis(trimethylsilane) (PubChem CID 163798288) has the molecular formula C25H54O2Si5
and a molecular weight of 527.14 g/mol. Its IUPAC name is bis(hydroxy(trimethyl)silane);methyl(diphenyl)silane;bis(trimethylsilane).
Molecular Properties
| Compound Name | bis(hydroxy(trimethyl)silane);methyl(diphenyl)silane;bis(trimethylsilane) |
| PubChem CID | 163798288 |
| Molecular Formula | C25H54O2Si5 |
| Molecular Weight | 527.14 g/mol |
| Exact Mass | 526.30 |
| IUPAC Name | bis(hydroxy(trimethyl)silane);methyl(diphenyl)silane;bis(trimethylsilane) |
| SMILES | C[SiH](C)C.C[SiH](C)C.C[SiH](c1ccccc1)c1ccccc1.C[Si](C)(C)O.C[Si](C)(C)O |
| InChI | InChI=1S/C13H14Si.2C3H10OSi.2C3H10Si/c1-14(12-8-4-2-5-9-12)13-10-6-3-7-11-13;2*1-5(2,3)4;2*1-4(2)3/h2-11,14H,1H3;2*4H,1-3H3;2*4H,1-3H3 |
| InChIKey | NCSXWOURSWQBLY-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 527.14 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze bis(hydroxy(trimethyl)silane);methyl(diphenyl)silane;bis(trimethylsilane) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(hydroxy(trimethyl)silane);methyl(diphenyl)silane;bis(trimethylsilane)?
The IUPAC name of bis(hydroxy(trimethyl)silane);methyl(diphenyl)silane;bis(trimethylsilane) (CID 163798288) is bis(hydroxy(trimethyl)silane);methyl(diphenyl)silane;bis(trimethylsilane).
What is the SMILES notation for bis(hydroxy(trimethyl)silane);methyl(diphenyl)silane;bis(trimethylsilane)?
The canonical SMILES for bis(hydroxy(trimethyl)silane);methyl(diphenyl)silane;bis(trimethylsilane) is C[SiH](C)C.C[SiH](C)C.C[SiH](c1ccccc1)c1ccccc1.C[Si](C)(C)O.C[Si](C)(C)O.
What is the InChIKey of bis(hydroxy(trimethyl)silane);methyl(diphenyl)silane;bis(trimethylsilane)?
The InChIKey is NCSXWOURSWQBLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14Si.2C3H10OSi.2C3H10Si/c1-14(12-8-4-2-5-9-12)13-10-6-3-7-11-13;2*1-5(2,3)4;2*1-4(2)3/h2-11,14H,1H3;2*4H,1-3H3;2*4H,1-3H3.
What are the key properties of bis(hydroxy(trimethyl)silane);methyl(diphenyl)silane;bis(trimethylsilane)?
bis(hydroxy(trimethyl)silane);methyl(diphenyl)silane;bis(trimethylsilane) has a molecular weight of 527.14 g/mol, XLogP of 5.49, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bis(hydroxy(trimethyl)silane);methyl(diphenyl)silane;bis(trimethylsilane) is sourced from PubChem (CID 163798288), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).