C11H22O2Si3 — CID 152695807
dimethylsilyloxy-dimethyl-[methyl(phenyl)silyl]oxysilane (PubChem CID 152695807) has the molecular formula C11H22O2Si3 and a molecular weight of 270.55 g/mol. Its IUPAC name is dimethylsilyloxy-dimethyl-[methyl(phenyl)silyl]oxysilane.
| Compound Name | dimethylsilyloxy-dimethyl-[methyl(phenyl)silyl]oxysilane |
|---|---|
| PubChem CID | 152695807 |
| Molecular Formula | C11H22O2Si3 |
| Molecular Weight | 270.55 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | dimethylsilyloxy-dimethyl-[methyl(phenyl)silyl]oxysilane |
| SMILES | C[SiH](C)O[Si](C)(C)O[SiH](C)c1ccccc1 |
| InChI | InChI=1S/C11H22O2Si3/c1-14(2)12-16(4,5)13-15(3)11-9-7-6-8-10-11/h6-10,14-15H,1-5H3 |
| InChIKey | ZQNGTHIQCLPYDI-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.55 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|