C10H34O3Si5 — CID 159136020
bis(dimethylsilyloxy)-dimethylsilane;dimethylsilyloxy(dimethyl)silane (PubChem CID 159136020) has the molecular formula C10H34O3Si5 and a molecular weight of 342.81 g/mol. Its IUPAC name is bis(dimethylsilyloxy)-dimethylsilane;dimethylsilyloxy(dimethyl)silane.
| Compound Name | bis(dimethylsilyloxy)-dimethylsilane;dimethylsilyloxy(dimethyl)silane |
|---|---|
| PubChem CID | 159136020 |
| Molecular Formula | C10H34O3Si5 |
| Molecular Weight | 342.81 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | bis(dimethylsilyloxy)-dimethylsilane;dimethylsilyloxy(dimethyl)silane |
| SMILES | C[SiH](C)O[SiH](C)C.C[SiH](C)O[Si](C)(C)O[SiH](C)C |
| InChI | InChI=1S/C6H20O2Si3.C4H14OSi2/c1-9(2)7-11(5,6)8-10(3)4;1-6(2)5-7(3)4/h9-10H,1-6H3;6-7H,1-4H3 |
| InChIKey | KHMQQZIXSHYBPO-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.81 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|