C8H18OSi2 — CID 174852792
acetylene;dimethylsilyloxy(dimethyl)silane (PubChem CID 174852792) has the molecular formula C8H18OSi2 and a molecular weight of 186.40 g/mol. Its IUPAC name is acetylene;dimethylsilyloxy(dimethyl)silane.
| Compound Name | acetylene;dimethylsilyloxy(dimethyl)silane |
|---|---|
| PubChem CID | 174852792 |
| Molecular Formula | C8H18OSi2 |
| Molecular Weight | 186.40 g/mol |
| Exact Mass | 186.09 |
| IUPAC Name | acetylene;dimethylsilyloxy(dimethyl)silane |
| SMILES | C#C.C#C.C[SiH](C)O[SiH](C)C |
| InChI | InChI=1S/C4H14OSi2.2C2H2/c1-6(2)5-7(3)4;2*1-2/h6-7H,1-4H3;2*1-2H |
| InChIKey | RYBULLIVABSOAB-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.40 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|