C31H42O4Si4 — CID 123658568
[dimethyl-(4-phenylphenoxy)silyl]oxy-dimethylsilyloxy-dimethylsilane;methoxy(diphenyl)silane (PubChem CID 123658568) has the molecular formula C31H42O4Si4 and a molecular weight of 591.02 g/mol. Its IUPAC name is [dimethyl-(4-phenylphenoxy)silyl]oxy-dimethylsilyloxy-dimethylsilane;methoxy(diphenyl)silane.
| Compound Name | [dimethyl-(4-phenylphenoxy)silyl]oxy-dimethylsilyloxy-dimethylsilane;methoxy(diphenyl)silane |
|---|---|
| PubChem CID | 123658568 |
| Molecular Formula | C31H42O4Si4 |
| Molecular Weight | 591.02 g/mol |
| Exact Mass | 590.22 |
| IUPAC Name | [dimethyl-(4-phenylphenoxy)silyl]oxy-dimethylsilyloxy-dimethylsilane;methoxy(diphenyl)silane |
| SMILES | CO[SiH](c1ccccc1)c1ccccc1.C[SiH](C)O[Si](C)(C)O[Si](C)(C)Oc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C18H28O3Si3.C13H14OSi/c1-22(2)20-24(5,6)21-23(3,4)19-18-14-12-17(13-15-18)16-10-8-7-9-11-16;1-14-15(12-8-4-2-5-9-12)13-10-6-3-7-11-13/h7-15,22H,1-6H3;2-11,15H,1H3 |
| InChIKey | VKJQTHBGZPNNGL-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.02 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|