About methoxy(dimethyl)silane;methoxy-methyl-phenylsilane
methoxy(dimethyl)silane;methoxy-methyl-phenylsilane (PubChem CID 158944051) has the molecular formula C11H22O2Si2
and a molecular weight of 242.47 g/mol. Its IUPAC name is methoxy(dimethyl)silane;methoxy-methyl-phenylsilane.
Molecular Properties
| Compound Name | methoxy(dimethyl)silane;methoxy-methyl-phenylsilane |
| PubChem CID | 158944051 |
| Molecular Formula | C11H22O2Si2 |
| Molecular Weight | 242.47 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | methoxy(dimethyl)silane;methoxy-methyl-phenylsilane |
| SMILES | CO[SiH](C)C.CO[SiH](C)c1ccccc1 |
| InChI | InChI=1S/C8H12OSi.C3H10OSi/c1-9-10(2)8-6-4-3-5-7-8;1-4-5(2)3/h3-7,10H,1-2H3;5H,1-3H3 |
| InChIKey | JKPJGYZHRAYTPF-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.47 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze methoxy(dimethyl)silane;methoxy-methyl-phenylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methoxy(dimethyl)silane;methoxy-methyl-phenylsilane?
The IUPAC name of methoxy(dimethyl)silane;methoxy-methyl-phenylsilane (CID 158944051) is methoxy(dimethyl)silane;methoxy-methyl-phenylsilane.
What is the SMILES notation for methoxy(dimethyl)silane;methoxy-methyl-phenylsilane?
The canonical SMILES for methoxy(dimethyl)silane;methoxy-methyl-phenylsilane is CO[SiH](C)C.CO[SiH](C)c1ccccc1.
What is the InChIKey of methoxy(dimethyl)silane;methoxy-methyl-phenylsilane?
The InChIKey is JKPJGYZHRAYTPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12OSi.C3H10OSi/c1-9-10(2)8-6-4-3-5-7-8;1-4-5(2)3/h3-7,10H,1-2H3;5H,1-3H3.
What are the key properties of methoxy(dimethyl)silane;methoxy-methyl-phenylsilane?
methoxy(dimethyl)silane;methoxy-methyl-phenylsilane has a molecular weight of 242.47 g/mol, XLogP of 1.51, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methoxy(dimethyl)silane;methoxy-methyl-phenylsilane is sourced from PubChem (CID 158944051), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).