About dimethyl(phenyl)silane;hydrochloride
dimethyl(phenyl)silane;hydrochloride (PubChem CID 172741806) has the molecular formula C8H13ClSi
and a molecular weight of 172.73 g/mol. Its IUPAC name is dimethyl(phenyl)silane;hydrochloride.
Molecular Properties
| Compound Name | dimethyl(phenyl)silane;hydrochloride |
| PubChem CID | 172741806 |
| Molecular Formula | C8H13ClSi |
| Molecular Weight | 172.73 g/mol |
| Exact Mass | 172.05 |
| IUPAC Name | dimethyl(phenyl)silane;hydrochloride |
| SMILES | C[SiH](C)c1ccccc1.Cl |
| InChI | InChI=1S/C8H12Si.ClH/c1-9(2)8-6-4-3-5-7-8;/h3-7,9H,1-2H3;1H |
| InChIKey | NTIUZMQTVYPKIB-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.73 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze dimethyl(phenyl)silane;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl(phenyl)silane;hydrochloride?
The IUPAC name of dimethyl(phenyl)silane;hydrochloride (CID 172741806) is dimethyl(phenyl)silane;hydrochloride.
What is the SMILES notation for dimethyl(phenyl)silane;hydrochloride?
The canonical SMILES for dimethyl(phenyl)silane;hydrochloride is C[SiH](C)c1ccccc1.Cl.
What is the InChIKey of dimethyl(phenyl)silane;hydrochloride?
The InChIKey is NTIUZMQTVYPKIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12Si.ClH/c1-9(2)8-6-4-3-5-7-8;/h3-7,9H,1-2H3;1H.
What are the key properties of dimethyl(phenyl)silane;hydrochloride?
dimethyl(phenyl)silane;hydrochloride has a molecular weight of 172.73 g/mol, XLogP of 1.80, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl(phenyl)silane;hydrochloride is sourced from PubChem (CID 172741806), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).