About diphenylsilylphosphane
diphenylsilylphosphane (PubChem CID 123635093) has the molecular formula C12H13PSi
and a molecular weight of 216.30 g/mol. Its IUPAC name is diphenylsilylphosphane.
Molecular Properties
| Compound Name | diphenylsilylphosphane |
| PubChem CID | 123635093 |
| Molecular Formula | C12H13PSi |
| Molecular Weight | 216.30 g/mol |
| Exact Mass | 216.05 |
| IUPAC Name | diphenylsilylphosphane |
| SMILES | P[SiH](c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C12H13PSi/c13-14(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10,14H,13H2 |
| InChIKey | GOKJCWMTGJUAAJ-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.30 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze diphenylsilylphosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diphenylsilylphosphane?
The IUPAC name of diphenylsilylphosphane (CID 123635093) is diphenylsilylphosphane.
What is the SMILES notation for diphenylsilylphosphane?
The canonical SMILES for diphenylsilylphosphane is P[SiH](c1ccccc1)c1ccccc1.
What is the InChIKey of diphenylsilylphosphane?
The InChIKey is GOKJCWMTGJUAAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13PSi/c13-14(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10,14H,13H2.
What are the key properties of diphenylsilylphosphane?
diphenylsilylphosphane has a molecular weight of 216.30 g/mol, XLogP of 1.40, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for diphenylsilylphosphane is sourced from PubChem (CID 123635093), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).