About dioxovanadium;hydroxy(diphenyl)silane
dioxovanadium;hydroxy(diphenyl)silane (PubChem CID 173411573) has the molecular formula C12H12O3SiV
and a molecular weight of 283.25 g/mol. Its IUPAC name is dioxovanadium;hydroxy(diphenyl)silane.
Molecular Properties
| Compound Name | dioxovanadium;hydroxy(diphenyl)silane |
| PubChem CID | 173411573 |
| Molecular Formula | C12H12O3SiV |
| Molecular Weight | 283.25 g/mol |
| Exact Mass | 283.00 |
| IUPAC Name | dioxovanadium;hydroxy(diphenyl)silane |
| SMILES | O=[V]=O.O[SiH](c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C12H12OSi.2O.V/c13-14(11-7-3-1-4-8-11)12-9-5-2-6-10-12;;;/h1-10,13-14H;;; |
| InChIKey | DEOAYVGQEYQZME-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.25 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze dioxovanadium;hydroxy(diphenyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dioxovanadium;hydroxy(diphenyl)silane?
The IUPAC name of dioxovanadium;hydroxy(diphenyl)silane (CID 173411573) is dioxovanadium;hydroxy(diphenyl)silane.
What is the SMILES notation for dioxovanadium;hydroxy(diphenyl)silane?
The canonical SMILES for dioxovanadium;hydroxy(diphenyl)silane is O=[V]=O.O[SiH](c1ccccc1)c1ccccc1.
What is the InChIKey of dioxovanadium;hydroxy(diphenyl)silane?
The InChIKey is DEOAYVGQEYQZME-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12OSi.2O.V/c13-14(11-7-3-1-4-8-11)12-9-5-2-6-10-12;;;/h1-10,13-14H;;;.
What are the key properties of dioxovanadium;hydroxy(diphenyl)silane?
dioxovanadium;hydroxy(diphenyl)silane has a molecular weight of 283.25 g/mol, XLogP of 0.28, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for dioxovanadium;hydroxy(diphenyl)silane is sourced from PubChem (CID 173411573), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).