About butane;hydroxy(diphenyl)silane
butane;hydroxy(diphenyl)silane (PubChem CID 159224288) has the molecular formula C16H22OSi
and a molecular weight of 258.44 g/mol. Its IUPAC name is butane;hydroxy(diphenyl)silane.
Molecular Properties
| Compound Name | butane;hydroxy(diphenyl)silane |
| PubChem CID | 159224288 |
| Molecular Formula | C16H22OSi |
| Molecular Weight | 258.44 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | butane;hydroxy(diphenyl)silane |
| SMILES | CCCC.O[SiH](c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C12H12OSi.C4H10/c13-14(11-7-3-1-4-8-11)12-9-5-2-6-10-12;1-3-4-2/h1-10,13-14H;3-4H2,1-2H3 |
| InChIKey | KSBYZKRJVLPYOB-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.44 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze butane;hydroxy(diphenyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butane;hydroxy(diphenyl)silane?
The IUPAC name of butane;hydroxy(diphenyl)silane (CID 159224288) is butane;hydroxy(diphenyl)silane.
What is the SMILES notation for butane;hydroxy(diphenyl)silane?
The canonical SMILES for butane;hydroxy(diphenyl)silane is CCCC.O[SiH](c1ccccc1)c1ccccc1.
What is the InChIKey of butane;hydroxy(diphenyl)silane?
The InChIKey is KSBYZKRJVLPYOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12OSi.C4H10/c13-14(11-7-3-1-4-8-11)12-9-5-2-6-10-12;1-3-4-2/h1-10,13-14H;3-4H2,1-2H3.
What are the key properties of butane;hydroxy(diphenyl)silane?
butane;hydroxy(diphenyl)silane has a molecular weight of 258.44 g/mol, XLogP of 2.32, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for butane;hydroxy(diphenyl)silane is sourced from PubChem (CID 159224288), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).