About butylphosphane;bis(hydroxy(diphenyl)silane)
butylphosphane;bis(hydroxy(diphenyl)silane) (PubChem CID 158988932) has the molecular formula C28H35O2PSi2
and a molecular weight of 490.73 g/mol. Its IUPAC name is butylphosphane;bis(hydroxy(diphenyl)silane).
Molecular Properties
| Compound Name | butylphosphane;bis(hydroxy(diphenyl)silane) |
| PubChem CID | 158988932 |
| Molecular Formula | C28H35O2PSi2 |
| Molecular Weight | 490.73 g/mol |
| Exact Mass | 490.19 |
| IUPAC Name | butylphosphane;bis(hydroxy(diphenyl)silane) |
| SMILES | CCCCP.O[SiH](c1ccccc1)c1ccccc1.O[SiH](c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/2C12H12OSi.C4H11P/c2*13-14(11-7-3-1-4-8-11)12-9-5-2-6-10-12;1-2-3-4-5/h2*1-10,13-14H;2-5H2,1H3 |
| InChIKey | JPXOVUKSLSHNMV-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 490.73 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze butylphosphane;bis(hydroxy(diphenyl)silane) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butylphosphane;bis(hydroxy(diphenyl)silane)?
The IUPAC name of butylphosphane;bis(hydroxy(diphenyl)silane) (CID 158988932) is butylphosphane;bis(hydroxy(diphenyl)silane).
What is the SMILES notation for butylphosphane;bis(hydroxy(diphenyl)silane)?
The canonical SMILES for butylphosphane;bis(hydroxy(diphenyl)silane) is CCCCP.O[SiH](c1ccccc1)c1ccccc1.O[SiH](c1ccccc1)c1ccccc1.
What is the InChIKey of butylphosphane;bis(hydroxy(diphenyl)silane)?
The InChIKey is JPXOVUKSLSHNMV-UHFFFAOYSA-N. The full InChI is InChI=1S/2C12H12OSi.C4H11P/c2*13-14(11-7-3-1-4-8-11)12-9-5-2-6-10-12;1-2-3-4-5/h2*1-10,13-14H;2-5H2,1H3.
What are the key properties of butylphosphane;bis(hydroxy(diphenyl)silane)?
butylphosphane;bis(hydroxy(diphenyl)silane) has a molecular weight of 490.73 g/mol, XLogP of 2.70, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for butylphosphane;bis(hydroxy(diphenyl)silane) is sourced from PubChem (CID 158988932), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).