C16H25O4P — CID 160516676
butylphosphane;diethyl benzene-1,2-dicarboxylate (PubChem CID 160516676) has the molecular formula C16H25O4P and a molecular weight of 312.35 g/mol. Its IUPAC name is butylphosphane;diethyl benzene-1,2-dicarboxylate.
| Compound Name | butylphosphane;diethyl benzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 160516676 |
| Molecular Formula | C16H25O4P |
| Molecular Weight | 312.35 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | butylphosphane;diethyl benzene-1,2-dicarboxylate |
| SMILES | CCCCP.CCOC(=O)c1ccccc1C(=O)OCC |
| InChI | InChI=1S/C12H14O4.C4H11P/c1-3-15-11(13)9-7-5-6-8-10(9)12(14)16-4-2;1-2-3-4-5/h5-8H,3-4H2,1-2H3;2-5H2,1H3 |
| InChIKey | QTTCQRZQJSWGEW-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.35 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|