C19H23O4P — CID 174586707
diethyl benzene-1,2-dicarboxylate;(4-methylphenyl)phosphane (PubChem CID 174586707) has the molecular formula C19H23O4P and a molecular weight of 346.36 g/mol. Its IUPAC name is diethyl benzene-1,2-dicarboxylate;(4-methylphenyl)phosphane.
| Compound Name | diethyl benzene-1,2-dicarboxylate;(4-methylphenyl)phosphane |
|---|---|
| PubChem CID | 174586707 |
| Molecular Formula | C19H23O4P |
| Molecular Weight | 346.36 g/mol |
| Exact Mass | 346.13 |
| IUPAC Name | diethyl benzene-1,2-dicarboxylate;(4-methylphenyl)phosphane |
| SMILES | CCOC(=O)c1ccccc1C(=O)OCC.Cc1ccc(P)cc1 |
| InChI | InChI=1S/C12H14O4.C7H9P/c1-3-15-11(13)9-7-5-6-8-10(9)12(14)16-4-2;1-6-2-4-7(8)5-3-6/h5-8H,3-4H2,1-2H3;2-5H,8H2,1H3 |
| InChIKey | JWDXLZPUAVFVBF-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.36 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|