C20H27O7PS — CID 174842450
diethyl benzene-1,2-dicarboxylate;2-methylbenzenesulfonic acid;methylphosphane (PubChem CID 174842450) has the molecular formula C20H27O7PS and a molecular weight of 442.47 g/mol. Its IUPAC name is diethyl benzene-1,2-dicarboxylate;2-methylbenzenesulfonic acid;methylphosphane.
| Compound Name | diethyl benzene-1,2-dicarboxylate;2-methylbenzenesulfonic acid;methylphosphane |
|---|---|
| PubChem CID | 174842450 |
| Molecular Formula | C20H27O7PS |
| Molecular Weight | 442.47 g/mol |
| Exact Mass | 442.12 |
| IUPAC Name | diethyl benzene-1,2-dicarboxylate;2-methylbenzenesulfonic acid;methylphosphane |
| SMILES | CCOC(=O)c1ccccc1C(=O)OCC.CP.Cc1ccccc1S(=O)(=O)O |
| InChI | InChI=1S/C12H14O4.C7H8O3S.CH5P/c1-3-15-11(13)9-7-5-6-8-10(9)12(14)16-4-2;1-6-4-2-3-5-7(6)11(8,9)10;1-2/h5-8H,3-4H2,1-2H3;2-5H,1H3,(H,8,9,10);2H2,1H3 |
| InChIKey | JBELFGXXVFADLU-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.47 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|