About acetic acid;bromobenzene;hexylphosphane
acetic acid;bromobenzene;hexylphosphane (PubChem CID 175278316) has the molecular formula C14H24BrO2P
and a molecular weight of 335.22 g/mol. Its IUPAC name is acetic acid;bromobenzene;hexylphosphane.
Molecular Properties
| Compound Name | acetic acid;bromobenzene;hexylphosphane |
| PubChem CID | 175278316 |
| Molecular Formula | C14H24BrO2P |
| Molecular Weight | 335.22 g/mol |
| Exact Mass | 334.07 |
| IUPAC Name | acetic acid;bromobenzene;hexylphosphane |
| SMILES | Brc1ccccc1.CC(=O)O.CCCCCCP |
| InChI | InChI=1S/C6H5Br.C6H15P.C2H4O2/c7-6-4-2-1-3-5-6;1-2-3-4-5-6-7;1-2(3)4/h1-5H;2-7H2,1H3;1H3,(H,3,4) |
| InChIKey | ZLQFLSCFARKJET-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.22 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze acetic acid;bromobenzene;hexylphosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;bromobenzene;hexylphosphane?
The IUPAC name of acetic acid;bromobenzene;hexylphosphane (CID 175278316) is acetic acid;bromobenzene;hexylphosphane.
What is the SMILES notation for acetic acid;bromobenzene;hexylphosphane?
The canonical SMILES for acetic acid;bromobenzene;hexylphosphane is Brc1ccccc1.CC(=O)O.CCCCCCP.
What is the InChIKey of acetic acid;bromobenzene;hexylphosphane?
The InChIKey is ZLQFLSCFARKJET-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5Br.C6H15P.C2H4O2/c7-6-4-2-1-3-5-6;1-2-3-4-5-6-7;1-2(3)4/h1-5H;2-7H2,1H3;1H3,(H,3,4).
What are the key properties of acetic acid;bromobenzene;hexylphosphane?
acetic acid;bromobenzene;hexylphosphane has a molecular weight of 335.22 g/mol, XLogP of 4.98, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;bromobenzene;hexylphosphane is sourced from PubChem (CID 175278316), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).