About dihydroxy(dioxo)chromium;bis(triphenylsilane)
dihydroxy(dioxo)chromium;bis(triphenylsilane) (PubChem CID 159722761) has the molecular formula C36H34CrO4Si2
and a molecular weight of 638.83 g/mol. Its IUPAC name is dihydroxy(dioxo)chromium;bis(triphenylsilane).
Molecular Properties
| Compound Name | dihydroxy(dioxo)chromium;bis(triphenylsilane) |
| PubChem CID | 159722761 |
| Molecular Formula | C36H34CrO4Si2 |
| Molecular Weight | 638.83 g/mol |
| Exact Mass | 638.14 |
| IUPAC Name | dihydroxy(dioxo)chromium;bis(triphenylsilane) |
| SMILES | O=[Cr](=O)(O)O.c1ccc([SiH](c2ccccc2)c2ccccc2)cc1.c1ccc([SiH](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/2C18H16Si.Cr.2H2O.2O/c2*1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;;;;;/h2*1-15,19H;;2*1H2;;/q;;+2;;;;/p-2 |
| InChIKey | HSEFWEZLKUYBON-UHFFFAOYSA-L |
| XLogP | 2.52 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 638.83 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze dihydroxy(dioxo)chromium;bis(triphenylsilane) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dihydroxy(dioxo)chromium;bis(triphenylsilane)?
The IUPAC name of dihydroxy(dioxo)chromium;bis(triphenylsilane) (CID 159722761) is dihydroxy(dioxo)chromium;bis(triphenylsilane).
What is the SMILES notation for dihydroxy(dioxo)chromium;bis(triphenylsilane)?
The canonical SMILES for dihydroxy(dioxo)chromium;bis(triphenylsilane) is O=[Cr](=O)(O)O.c1ccc([SiH](c2ccccc2)c2ccccc2)cc1.c1ccc([SiH](c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of dihydroxy(dioxo)chromium;bis(triphenylsilane)?
The InChIKey is HSEFWEZLKUYBON-UHFFFAOYSA-L. The full InChI is InChI=1S/2C18H16Si.Cr.2H2O.2O/c2*1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;;;;;/h2*1-15,19H;;2*1H2;;/q;;+2;;;;/p-2.
What are the key properties of dihydroxy(dioxo)chromium;bis(triphenylsilane)?
dihydroxy(dioxo)chromium;bis(triphenylsilane) has a molecular weight of 638.83 g/mol, XLogP of 2.52, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dihydroxy(dioxo)chromium;bis(triphenylsilane) is sourced from PubChem (CID 159722761), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).