About dihydroxy(dioxo)chromium;ditritylsilane
dihydroxy(dioxo)chromium;ditritylsilane (PubChem CID 159004940) has the molecular formula C38H34CrO4Si
and a molecular weight of 634.77 g/mol. Its IUPAC name is dihydroxy(dioxo)chromium;ditritylsilane.
Molecular Properties
| Compound Name | dihydroxy(dioxo)chromium;ditritylsilane |
| PubChem CID | 159004940 |
| Molecular Formula | C38H34CrO4Si |
| Molecular Weight | 634.77 g/mol |
| Exact Mass | 634.16 |
| IUPAC Name | dihydroxy(dioxo)chromium;ditritylsilane |
| SMILES | O=[Cr](=O)(O)O.c1ccc(C([SiH2]C(c2ccccc2)(c2ccccc2)c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C38H32Si.Cr.2H2O.2O/c1-7-19-31(20-8-1)37(32-21-9-2-10-22-32,33-23-11-3-12-24-33)39-38(34-25-13-4-14-26-34,35-27-15-5-16-28-35)36-29-17-6-18-30-36;;;;;/h1-30H,39H2;;2*1H2;;/q;+2;;;;/p-2 |
| InChIKey | CGJWZBXTVPJGIU-UHFFFAOYSA-L |
| XLogP | 6.79 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 634.77 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze dihydroxy(dioxo)chromium;ditritylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dihydroxy(dioxo)chromium;ditritylsilane?
The IUPAC name of dihydroxy(dioxo)chromium;ditritylsilane (CID 159004940) is dihydroxy(dioxo)chromium;ditritylsilane.
What is the SMILES notation for dihydroxy(dioxo)chromium;ditritylsilane?
The canonical SMILES for dihydroxy(dioxo)chromium;ditritylsilane is O=[Cr](=O)(O)O.c1ccc(C([SiH2]C(c2ccccc2)(c2ccccc2)c2ccccc2)(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of dihydroxy(dioxo)chromium;ditritylsilane?
The InChIKey is CGJWZBXTVPJGIU-UHFFFAOYSA-L. The full InChI is InChI=1S/C38H32Si.Cr.2H2O.2O/c1-7-19-31(20-8-1)37(32-21-9-2-10-22-32,33-23-11-3-12-24-33)39-38(34-25-13-4-14-26-34,35-27-15-5-16-28-35)36-29-17-6-18-30-36;;;;;/h1-30H,39H2;;2*1H2;;/q;+2;;;;/p-2.
What are the key properties of dihydroxy(dioxo)chromium;ditritylsilane?
dihydroxy(dioxo)chromium;ditritylsilane has a molecular weight of 634.77 g/mol, XLogP of 6.79, 8 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dihydroxy(dioxo)chromium;ditritylsilane is sourced from PubChem (CID 159004940), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).