About diphenylmethanediol;dihydrochloride
diphenylmethanediol;dihydrochloride (PubChem CID 174953837) has the molecular formula C13H14Cl2O2
and a molecular weight of 273.16 g/mol. Its IUPAC name is diphenylmethanediol;dihydrochloride.
Molecular Properties
| Compound Name | diphenylmethanediol;dihydrochloride |
| PubChem CID | 174953837 |
| Molecular Formula | C13H14Cl2O2 |
| Molecular Weight | 273.16 g/mol |
| Exact Mass | 272.04 |
| IUPAC Name | diphenylmethanediol;dihydrochloride |
| SMILES | Cl.Cl.OC(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C13H12O2.2ClH/c14-13(15,11-7-3-1-4-8-11)12-9-5-2-6-10-12;;/h1-10,14-15H;2*1H |
| InChIKey | CSHFLIBEBTYJKC-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.16 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze diphenylmethanediol;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diphenylmethanediol;dihydrochloride?
The IUPAC name of diphenylmethanediol;dihydrochloride (CID 174953837) is diphenylmethanediol;dihydrochloride.
What is the SMILES notation for diphenylmethanediol;dihydrochloride?
The canonical SMILES for diphenylmethanediol;dihydrochloride is Cl.Cl.OC(O)(c1ccccc1)c1ccccc1.
What is the InChIKey of diphenylmethanediol;dihydrochloride?
The InChIKey is CSHFLIBEBTYJKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12O2.2ClH/c14-13(15,11-7-3-1-4-8-11)12-9-5-2-6-10-12;;/h1-10,14-15H;2*1H.
What are the key properties of diphenylmethanediol;dihydrochloride?
diphenylmethanediol;dihydrochloride has a molecular weight of 273.16 g/mol, XLogP of 2.72, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for diphenylmethanediol;dihydrochloride is sourced from PubChem (CID 174953837), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).