About sodium;hydride;triphenylmethanol
sodium;hydride;triphenylmethanol (PubChem CID 174537383) has the molecular formula C19H17NaO
and a molecular weight of 284.33 g/mol. Its IUPAC name is sodium;hydride;triphenylmethanol.
Molecular Properties
| Compound Name | sodium;hydride;triphenylmethanol |
| PubChem CID | 174537383 |
| Molecular Formula | C19H17NaO |
| Molecular Weight | 284.33 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | sodium;hydride;triphenylmethanol |
| SMILES | OC(c1ccccc1)(c1ccccc1)c1ccccc1.[H-].[Na+] |
| InChI | InChI=1S/C19H16O.Na.H/c20-19(16-10-4-1-5-11-16,17-12-6-2-7-13-17)18-14-8-3-9-15-18;;/h1-15,20H;;/q;+1;-1 |
| InChIKey | WVDNCGRVZVGVTJ-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.33 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze sodium;hydride;triphenylmethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;hydride;triphenylmethanol?
The IUPAC name of sodium;hydride;triphenylmethanol (CID 174537383) is sodium;hydride;triphenylmethanol.
What is the SMILES notation for sodium;hydride;triphenylmethanol?
The canonical SMILES for sodium;hydride;triphenylmethanol is OC(c1ccccc1)(c1ccccc1)c1ccccc1.[H-].[Na+].
What is the InChIKey of sodium;hydride;triphenylmethanol?
The InChIKey is WVDNCGRVZVGVTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16O.Na.H/c20-19(16-10-4-1-5-11-16,17-12-6-2-7-13-17)18-14-8-3-9-15-18;;/h1-15,20H;;/q;+1;-1.
What are the key properties of sodium;hydride;triphenylmethanol?
sodium;hydride;triphenylmethanol has a molecular weight of 284.33 g/mol, XLogP of 1.09, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;hydride;triphenylmethanol is sourced from PubChem (CID 174537383), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).