About lithium bis(tritylsilyl)azanide
lithium bis(tritylsilyl)azanide (PubChem CID 172712508) has the molecular formula C38H34LiNSi2
and a molecular weight of 567.81 g/mol. Its IUPAC name is lithium bis(tritylsilyl)azanide.
Molecular Properties
| Compound Name | lithium bis(tritylsilyl)azanide |
| PubChem CID | 172712508 |
| Molecular Formula | C38H34LiNSi2 |
| Molecular Weight | 567.81 g/mol |
| Exact Mass | 567.24 |
| IUPAC Name | lithium bis(tritylsilyl)azanide |
| SMILES | [Li+].c1ccc(C([SiH2][N-][SiH2]C(c2ccccc2)(c2ccccc2)c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C38H34NSi2.Li/c1-7-19-31(20-8-1)37(32-21-9-2-10-22-32,33-23-11-3-12-24-33)40-39-41-38(34-25-13-4-14-26-34,35-27-15-5-16-28-35)36-29-17-6-18-30-36;/h1-30H,40-41H2;/q-1;+1 |
| InChIKey | FKXCYYIXJXXHJK-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 14.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 567.81 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze lithium bis(tritylsilyl)azanide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium bis(tritylsilyl)azanide?
The IUPAC name of lithium bis(tritylsilyl)azanide (CID 172712508) is lithium bis(tritylsilyl)azanide.
What is the SMILES notation for lithium bis(tritylsilyl)azanide?
The canonical SMILES for lithium bis(tritylsilyl)azanide is [Li+].c1ccc(C([SiH2][N-][SiH2]C(c2ccccc2)(c2ccccc2)c2ccccc2)(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of lithium bis(tritylsilyl)azanide?
The InChIKey is FKXCYYIXJXXHJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C38H34NSi2.Li/c1-7-19-31(20-8-1)37(32-21-9-2-10-22-32,33-23-11-3-12-24-33)40-39-41-38(34-25-13-4-14-26-34,35-27-15-5-16-28-35)36-29-17-6-18-30-36;/h1-30H,40-41H2;/q-1;+1.
What are the key properties of lithium bis(tritylsilyl)azanide?
lithium bis(tritylsilyl)azanide has a molecular weight of 567.81 g/mol, XLogP of 4.52, 10 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for lithium bis(tritylsilyl)azanide is sourced from PubChem (CID 172712508), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).