C25H20O2 — CID 171380903
4-[(1,2,3,4,5,6-13C6)cyclohexatrienyl-(4-hydroxyphenyl)-phenylmethyl]phenol (PubChem CID 171380903) has the molecular formula C25H20O2 and a molecular weight of 358.39 g/mol. Its IUPAC name is 4-[(1,2,3,4,5,6-13C6)cyclohexatrienyl-(4-hydroxyphenyl)-phenylmethyl]phenol.
| Compound Name | 4-[(1,2,3,4,5,6-13C6)cyclohexatrienyl-(4-hydroxyphenyl)-phenylmethyl]phenol |
|---|---|
| PubChem CID | 171380903 |
| Molecular Formula | C25H20O2 |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.17 |
| IUPAC Name | 4-[(1,2,3,4,5,6-13C6)cyclohexatrienyl-(4-hydroxyphenyl)-phenylmethyl]phenol |
| SMILES | Oc1ccc(C(c2ccccc2)(c2ccc(O)cc2)[13c]2[13cH][13cH][13cH][13cH][13cH]2)cc1 |
| InChI | InChI=1S/C25H20O2/c26-23-15-11-21(12-16-23)25(19-7-3-1-4-8-19,20-9-5-2-6-10-20)22-13-17-24(27)18-14-22/h1-18,26-27H/i1+1,3+1,4+1,7+1,8+1,19+1 |
| InChIKey | BATCUENAARTUKW-GEONCDEDSA-N |
| XLogP | 5.48 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|