C25H20O4 — CID 59253853
4-[(3,4-dihydroxyphenyl)-diphenylmethyl]benzene-1,2-diol (PubChem CID 59253853) has the molecular formula C25H20O4 and a molecular weight of 384.43 g/mol. Its IUPAC name is 4-[(3,4-dihydroxyphenyl)-diphenylmethyl]benzene-1,2-diol.
| Compound Name | 4-[(3,4-dihydroxyphenyl)-diphenylmethyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 59253853 |
| Molecular Formula | C25H20O4 |
| Molecular Weight | 384.43 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | 4-[(3,4-dihydroxyphenyl)-diphenylmethyl]benzene-1,2-diol |
| SMILES | Oc1ccc(C(c2ccccc2)(c2ccccc2)c2ccc(O)c(O)c2)cc1O |
| InChI | InChI=1S/C25H20O4/c26-21-13-11-19(15-23(21)28)25(17-7-3-1-4-8-17,18-9-5-2-6-10-18)20-12-14-22(27)24(29)16-20/h1-16,26-29H |
| InChIKey | XJTIGCYCYMOIOH-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.43 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|