C25H16I4O2 — CID 134267119
4-[(4-hydroxy-3,5-diiodophenyl)-diphenylmethyl]-2,6-diiodophenol (PubChem CID 134267119) has the molecular formula C25H16I4O2 and a molecular weight of 856.02 g/mol. Its IUPAC name is 4-[(4-hydroxy-3,5-diiodophenyl)-diphenylmethyl]-2,6-diiodophenol.
| Compound Name | 4-[(4-hydroxy-3,5-diiodophenyl)-diphenylmethyl]-2,6-diiodophenol |
|---|---|
| PubChem CID | 134267119 |
| Molecular Formula | C25H16I4O2 |
| Molecular Weight | 856.02 g/mol |
| Exact Mass | 855.73 |
| IUPAC Name | 4-[(4-hydroxy-3,5-diiodophenyl)-diphenylmethyl]-2,6-diiodophenol |
| SMILES | Oc1c(I)cc(C(c2ccccc2)(c2ccccc2)c2cc(I)c(O)c(I)c2)cc1I |
| InChI | InChI=1S/C25H16I4O2/c26-19-11-17(12-20(27)23(19)30)25(15-7-3-1-4-8-15,16-9-5-2-6-10-16)18-13-21(28)24(31)22(29)14-18/h1-14,30-31H |
| InChIKey | WHELUMIEBUVWDJ-UHFFFAOYSA-N |
| XLogP | 7.90 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 856.02 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|