C29H30N2 — CID 146638206
4-[(4-amino-3,5-dimethylphenyl)-diphenylmethyl]-2,6-dimethylaniline (PubChem CID 146638206) has the molecular formula C29H30N2 and a molecular weight of 406.57 g/mol. Its IUPAC name is 4-[(4-amino-3,5-dimethylphenyl)-diphenylmethyl]-2,6-dimethylaniline.
| Compound Name | 4-[(4-amino-3,5-dimethylphenyl)-diphenylmethyl]-2,6-dimethylaniline |
|---|---|
| PubChem CID | 146638206 |
| Molecular Formula | C29H30N2 |
| Molecular Weight | 406.57 g/mol |
| Exact Mass | 406.24 |
| IUPAC Name | 4-[(4-amino-3,5-dimethylphenyl)-diphenylmethyl]-2,6-dimethylaniline |
| SMILES | Cc1cc(C(c2ccccc2)(c2ccccc2)c2cc(C)c(N)c(C)c2)cc(C)c1N |
| InChI | InChI=1S/C29H30N2/c1-19-15-25(16-20(2)27(19)30)29(23-11-7-5-8-12-23,24-13-9-6-10-14-24)26-17-21(3)28(31)22(4)18-26/h5-18H,30-31H2,1-4H3 |
| InChIKey | VUWLCVFOYMMMJW-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.57 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|