C29H28O2 — CID 139721839
4-[(4-hydroxy-2,6-dimethylphenyl)-diphenylmethyl]-3,5-dimethylphenol (PubChem CID 139721839) has the molecular formula C29H28O2 and a molecular weight of 408.54 g/mol. Its IUPAC name is 4-[(4-hydroxy-2,6-dimethylphenyl)-diphenylmethyl]-3,5-dimethylphenol.
| Compound Name | 4-[(4-hydroxy-2,6-dimethylphenyl)-diphenylmethyl]-3,5-dimethylphenol |
|---|---|
| PubChem CID | 139721839 |
| Molecular Formula | C29H28O2 |
| Molecular Weight | 408.54 g/mol |
| Exact Mass | 408.21 |
| IUPAC Name | 4-[(4-hydroxy-2,6-dimethylphenyl)-diphenylmethyl]-3,5-dimethylphenol |
| SMILES | Cc1cc(O)cc(C)c1C(c1ccccc1)(c1ccccc1)c1c(C)cc(O)cc1C |
| InChI | InChI=1S/C29H28O2/c1-19-15-25(30)16-20(2)27(19)29(23-11-7-5-8-12-23,24-13-9-6-10-14-24)28-21(3)17-26(31)18-22(28)4/h5-18,30-31H,1-4H3 |
| InChIKey | ONUQILQEKZNXHN-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.54 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|