C14H14OSe — CID 10912804
3,5-dimethyl-4-phenylselanylphenol (PubChem CID 10912804) has the molecular formula C14H14OSe and a molecular weight of 277.22 g/mol. Its IUPAC name is 3,5-dimethyl-4-phenylselanylphenol.
| Compound Name | 3,5-dimethyl-4-phenylselanylphenol |
|---|---|
| PubChem CID | 10912804 |
| Molecular Formula | C14H14OSe |
| Molecular Weight | 277.22 g/mol |
| Exact Mass | 278.02 |
| IUPAC Name | 3,5-dimethyl-4-phenylselanylphenol |
| SMILES | Cc1cc(O)cc(C)c1[Se]c1ccccc1 |
| InChI | InChI=1S/C14H14OSe/c1-10-8-12(15)9-11(2)14(10)16-13-6-4-3-5-7-13/h3-9,15H,1-2H3 |
| InChIKey | UEMBYQZSUYHPKZ-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.22 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|