C15H15ClSe — CID 135029325
2-(2-chlorophenyl)selanyl-1,3,5-trimethylbenzene (PubChem CID 135029325) has the molecular formula C15H15ClSe and a molecular weight of 309.70 g/mol. Its IUPAC name is 2-(2-chlorophenyl)selanyl-1,3,5-trimethylbenzene.
| Compound Name | 2-(2-chlorophenyl)selanyl-1,3,5-trimethylbenzene |
|---|---|
| PubChem CID | 135029325 |
| Molecular Formula | C15H15ClSe |
| Molecular Weight | 309.70 g/mol |
| Exact Mass | 310.00 |
| IUPAC Name | 2-(2-chlorophenyl)selanyl-1,3,5-trimethylbenzene |
| SMILES | Cc1cc(C)c([Se]c2ccccc2Cl)c(C)c1 |
| InChI | InChI=1S/C15H15ClSe/c1-10-8-11(2)15(12(3)9-10)17-14-7-5-4-6-13(14)16/h4-9H,1-3H3 |
| InChIKey | MCCIYMMYATZCAQ-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.70 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|