C16H18Se — CID 132527662
1,3,5-trimethyl-2-(2-methylphenyl)selanylbenzene (PubChem CID 132527662) has the molecular formula C16H18Se and a molecular weight of 289.28 g/mol. Its IUPAC name is 1,3,5-trimethyl-2-(2-methylphenyl)selanylbenzene.
| Compound Name | 1,3,5-trimethyl-2-(2-methylphenyl)selanylbenzene |
|---|---|
| PubChem CID | 132527662 |
| Molecular Formula | C16H18Se |
| Molecular Weight | 289.28 g/mol |
| Exact Mass | 290.06 |
| IUPAC Name | 1,3,5-trimethyl-2-(2-methylphenyl)selanylbenzene |
| SMILES | Cc1cc(C)c([Se]c2ccccc2C)c(C)c1 |
| InChI | InChI=1S/C16H18Se/c1-11-9-13(3)16(14(4)10-11)17-15-8-6-5-7-12(15)2/h5-10H,1-4H3 |
| InChIKey | PKWVSXGJXUMPQX-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.28 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|