About CID 175370412
CID 175370412 (PubChem CID 175370412) has the molecular formula C6H4ClSe2
and a molecular weight of 269.47 g/mol.
Molecular Properties
| Compound Name | CID 175370412 |
| PubChem CID | 175370412 |
| Molecular Formula | C6H4ClSe2 |
| Molecular Weight | 269.47 g/mol |
| Exact Mass | 270.83 |
| IUPAC Name | — |
| SMILES | Clc1ccccc1[Se][Se] |
| InChI | InChI=1S/C6H4ClSe2/c7-5-3-1-2-4-6(5)9-8/h1-4H |
| InChIKey | HEKPYCUAQDNASR-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.47 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 175370412 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 175370412?
The IUPAC name of CID 175370412 (CID 175370412) is not available.
What is the SMILES notation for CID 175370412?
The canonical SMILES for CID 175370412 is Clc1ccccc1[Se][Se].
What is the InChIKey of CID 175370412?
The InChIKey is HEKPYCUAQDNASR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4ClSe2/c7-5-3-1-2-4-6(5)9-8/h1-4H.
What are the key properties of CID 175370412?
CID 175370412 has a molecular weight of 269.47 g/mol, XLogP of 0.75, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 175370412 is sourced from PubChem (CID 175370412), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).