About 1,2-dichlorobenzene;dichlorozinc
1,2-dichlorobenzene;dichlorozinc (PubChem CID 175431484) has the molecular formula C6H4Cl4Zn
and a molecular weight of 283.30 g/mol. Its IUPAC name is 1,2-dichlorobenzene;dichlorozinc.
Molecular Properties
| Compound Name | 1,2-dichlorobenzene;dichlorozinc |
| PubChem CID | 175431484 |
| Molecular Formula | C6H4Cl4Zn |
| Molecular Weight | 283.30 g/mol |
| Exact Mass | 279.84 |
| IUPAC Name | 1,2-dichlorobenzene;dichlorozinc |
| SMILES | Cl[Zn]Cl.Clc1ccccc1Cl |
| InChI | InChI=1S/C6H4Cl2.2ClH.Zn/c7-5-3-1-2-4-6(5)8;;;/h1-4H;2*1H;/q;;;+2/p-2 |
| InChIKey | ZHXJWRKRCAQKPA-UHFFFAOYSA-L |
| XLogP | 4.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.30 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1,2-dichlorobenzene;dichlorozinc with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dichlorobenzene;dichlorozinc?
The IUPAC name of 1,2-dichlorobenzene;dichlorozinc (CID 175431484) is 1,2-dichlorobenzene;dichlorozinc.
What is the SMILES notation for 1,2-dichlorobenzene;dichlorozinc?
The canonical SMILES for 1,2-dichlorobenzene;dichlorozinc is Cl[Zn]Cl.Clc1ccccc1Cl.
What is the InChIKey of 1,2-dichlorobenzene;dichlorozinc?
The InChIKey is ZHXJWRKRCAQKPA-UHFFFAOYSA-L. The full InChI is InChI=1S/C6H4Cl2.2ClH.Zn/c7-5-3-1-2-4-6(5)8;;;/h1-4H;2*1H;/q;;;+2/p-2.
What are the key properties of 1,2-dichlorobenzene;dichlorozinc?
1,2-dichlorobenzene;dichlorozinc has a molecular weight of 283.30 g/mol, XLogP of 4.37, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dichlorobenzene;dichlorozinc is sourced from PubChem (CID 175431484), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).