About carbon monoxide;chromium;1,2-dichlorobenzene
carbon monoxide;chromium;1,2-dichlorobenzene (PubChem CID 10924039) has the molecular formula C9H4Cl2CrO3
and a molecular weight of 283.03 g/mol. Its IUPAC name is carbon monoxide;chromium;1,2-dichlorobenzene.
Molecular Properties
| Compound Name | carbon monoxide;chromium;1,2-dichlorobenzene |
| PubChem CID | 10924039 |
| Molecular Formula | C9H4Cl2CrO3 |
| Molecular Weight | 283.03 g/mol |
| Exact Mass | 281.89 |
| IUPAC Name | carbon monoxide;chromium;1,2-dichlorobenzene |
| SMILES | Clc1ccccc1Cl.[C-]#[O+].[C-]#[O+].[C-]#[O+].[Cr] |
| InChI | InChI=1S/C6H4Cl2.3CO.Cr/c7-5-3-1-2-4-6(5)8;3*1-2;/h1-4H;;;; |
| InChIKey | XABUECNYWAPQGR-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 59.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.03 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze carbon monoxide;chromium;1,2-dichlorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbon monoxide;chromium;1,2-dichlorobenzene?
The IUPAC name of carbon monoxide;chromium;1,2-dichlorobenzene (CID 10924039) is carbon monoxide;chromium;1,2-dichlorobenzene.
What is the SMILES notation for carbon monoxide;chromium;1,2-dichlorobenzene?
The canonical SMILES for carbon monoxide;chromium;1,2-dichlorobenzene is Clc1ccccc1Cl.[C-]#[O+].[C-]#[O+].[C-]#[O+].[Cr].
What is the InChIKey of carbon monoxide;chromium;1,2-dichlorobenzene?
The InChIKey is XABUECNYWAPQGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4Cl2.3CO.Cr/c7-5-3-1-2-4-6(5)8;3*1-2;/h1-4H;;;;.
What are the key properties of carbon monoxide;chromium;1,2-dichlorobenzene?
carbon monoxide;chromium;1,2-dichlorobenzene has a molecular weight of 283.03 g/mol, XLogP of 2.88, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for carbon monoxide;chromium;1,2-dichlorobenzene is sourced from PubChem (CID 10924039), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).