carbon monoxide;chromium;1,2-dichlorobenzene

C9H4Cl2CrO3 — CID 10924039

IUPACcarbon monoxide;chromium;1,2-dichlorobenzene
SMILESClc1ccccc1Cl.[C-]#[O+].[C-]#[O+].[C-]#[O+].[Cr]
InChIInChI=1S/C6H4Cl2.3CO.Cr/c7-5-3-1-2-4-6(5)8;3*1-2;/h1-4H;;;;
InChIKeyXABUECNYWAPQGR-UHFFFAOYSA-N
MW283.03 g/mol
LogP2.88
Rot. Bonds

About carbon monoxide;chromium;1,2-dichlorobenzene

carbon monoxide;chromium;1,2-dichlorobenzene (PubChem CID 10924039) has the molecular formula C9H4Cl2CrO3 and a molecular weight of 283.03 g/mol. Its IUPAC name is carbon monoxide;chromium;1,2-dichlorobenzene.

Molecular Properties

Compound Namecarbon monoxide;chromium;1,2-dichlorobenzene
PubChem CID10924039
Molecular FormulaC9H4Cl2CrO3
Molecular Weight283.03 g/mol
Exact Mass281.89
IUPAC Namecarbon monoxide;chromium;1,2-dichlorobenzene
SMILESClc1ccccc1Cl.[C-]#[O+].[C-]#[O+].[C-]#[O+].[Cr]
InChIInChI=1S/C6H4Cl2.3CO.Cr/c7-5-3-1-2-4-6(5)8;3*1-2;/h1-4H;;;;
InChIKeyXABUECNYWAPQGR-UHFFFAOYSA-N
XLogP2.88
TPSA59.70 Ų
H-Bond Donors
H-Bond Acceptors
Rotatable Bonds
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500283.03
LogP ≤ 52.88
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 100

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}

Analyze carbon monoxide;chromium;1,2-dichlorobenzene with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of carbon monoxide;chromium;1,2-dichlorobenzene?
The IUPAC name of carbon monoxide;chromium;1,2-dichlorobenzene (CID 10924039) is carbon monoxide;chromium;1,2-dichlorobenzene.
What is the SMILES notation for carbon monoxide;chromium;1,2-dichlorobenzene?
The canonical SMILES for carbon monoxide;chromium;1,2-dichlorobenzene is Clc1ccccc1Cl.[C-]#[O+].[C-]#[O+].[C-]#[O+].[Cr].
What is the InChIKey of carbon monoxide;chromium;1,2-dichlorobenzene?
The InChIKey is XABUECNYWAPQGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4Cl2.3CO.Cr/c7-5-3-1-2-4-6(5)8;3*1-2;/h1-4H;;;;.
What are the key properties of carbon monoxide;chromium;1,2-dichlorobenzene?
carbon monoxide;chromium;1,2-dichlorobenzene has a molecular weight of 283.03 g/mol, XLogP of 2.88, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for carbon monoxide;chromium;1,2-dichlorobenzene is sourced from PubChem (CID 10924039), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).