C7H4Cl2O — CID 101073282
2,7-dichlorocyclohepta-2,4,6-trien-1-one (PubChem CID 101073282) has the molecular formula C7H4Cl2O and a molecular weight of 175.01 g/mol. Its IUPAC name is 2,7-dichlorocyclohepta-2,4,6-trien-1-one.
| Compound Name | 2,7-dichlorocyclohepta-2,4,6-trien-1-one |
|---|---|
| PubChem CID | 101073282 |
| Molecular Formula | C7H4Cl2O |
| Molecular Weight | 175.01 g/mol |
| Exact Mass | 173.96 |
| IUPAC Name | 2,7-dichlorocyclohepta-2,4,6-trien-1-one |
| SMILES | O=c1c(Cl)ccccc1Cl |
| InChI | InChI=1S/C7H4Cl2O/c8-5-3-1-2-4-6(9)7(5)10/h1-4H |
| InChIKey | HLNBOLXGYLJBTM-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.01 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |