C7H5ClO — CID 19691
2-chlorocyclohepta-2,4,6-trien-1-one (PubChem CID 19691) has the molecular formula C7H5ClO and a molecular weight of 140.57 g/mol. Its IUPAC name is 2-chlorocyclohepta-2,4,6-trien-1-one.
| Compound Name | 2-chlorocyclohepta-2,4,6-trien-1-one |
|---|---|
| PubChem CID | 19691 |
| Molecular Formula | C7H5ClO |
| Molecular Weight | 140.57 g/mol |
| Exact Mass | 140.00 |
| IUPAC Name | 2-chlorocyclohepta-2,4,6-trien-1-one |
| SMILES | O=c1cccccc1Cl |
| InChI | InChI=1S/C7H5ClO/c8-6-4-2-1-3-5-7(6)9/h1-5H |
| InChIKey | MTHNMAUDCHXFMM-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.57 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |