sodium 2-hydroxycyclohepta-2,4,6-trien-1-one

C7H6NaO2+ — CID 23036587

IUPACsodium 2-hydroxycyclohepta-2,4,6-trien-1-one
SMILESO=c1cccccc1O.[Na+]
InChIInChI=1S/C7H6O2.Na/c8-6-4-2-1-3-5-7(6)9;/h1-5H,(H,8,9);/q;+1
InChIKeyTVJTZDVUEBDLQP-UHFFFAOYSA-N
MW145.11 g/mol
LogP-2.24
Rot. Bonds

About sodium 2-hydroxycyclohepta-2,4,6-trien-1-one

sodium 2-hydroxycyclohepta-2,4,6-trien-1-one (PubChem CID 23036587) has the molecular formula C7H6NaO2+ and a molecular weight of 145.11 g/mol. Its IUPAC name is sodium 2-hydroxycyclohepta-2,4,6-trien-1-one.

Molecular Properties

Compound Namesodium 2-hydroxycyclohepta-2,4,6-trien-1-one
PubChem CID23036587
Molecular FormulaC7H6NaO2+
Molecular Weight145.11 g/mol
Exact Mass145.03
IUPAC Namesodium 2-hydroxycyclohepta-2,4,6-trien-1-one
SMILESO=c1cccccc1O.[Na+]
InChIInChI=1S/C7H6O2.Na/c8-6-4-2-1-3-5-7(6)9;/h1-5H,(H,8,9);/q;+1
InChIKeyTVJTZDVUEBDLQP-UHFFFAOYSA-N
XLogP-2.24
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds
Heavy Atoms10
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500145.11
LogP ≤ 5-2.24
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze sodium 2-hydroxycyclohepta-2,4,6-trien-1-one with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of sodium 2-hydroxycyclohepta-2,4,6-trien-1-one?
The IUPAC name of sodium 2-hydroxycyclohepta-2,4,6-trien-1-one (CID 23036587) is sodium 2-hydroxycyclohepta-2,4,6-trien-1-one.
What is the SMILES notation for sodium 2-hydroxycyclohepta-2,4,6-trien-1-one?
The canonical SMILES for sodium 2-hydroxycyclohepta-2,4,6-trien-1-one is O=c1cccccc1O.[Na+].
What is the InChIKey of sodium 2-hydroxycyclohepta-2,4,6-trien-1-one?
The InChIKey is TVJTZDVUEBDLQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6O2.Na/c8-6-4-2-1-3-5-7(6)9;/h1-5H,(H,8,9);/q;+1.
What are the key properties of sodium 2-hydroxycyclohepta-2,4,6-trien-1-one?
sodium 2-hydroxycyclohepta-2,4,6-trien-1-one has a molecular weight of 145.11 g/mol, XLogP of -2.24, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 2-hydroxycyclohepta-2,4,6-trien-1-one is sourced from PubChem (CID 23036587), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).