C7H6NaO2+ — CID 23036587
sodium 2-hydroxycyclohepta-2,4,6-trien-1-one (PubChem CID 23036587) has the molecular formula C7H6NaO2+ and a molecular weight of 145.11 g/mol. Its IUPAC name is sodium 2-hydroxycyclohepta-2,4,6-trien-1-one.
| Compound Name | sodium 2-hydroxycyclohepta-2,4,6-trien-1-one |
|---|---|
| PubChem CID | 23036587 |
| Molecular Formula | C7H6NaO2+ |
| Molecular Weight | 145.11 g/mol |
| Exact Mass | 145.03 |
| IUPAC Name | sodium 2-hydroxycyclohepta-2,4,6-trien-1-one |
| SMILES | O=c1cccccc1O.[Na+] |
| InChI | InChI=1S/C7H6O2.Na/c8-6-4-2-1-3-5-7(6)9;/h1-5H,(H,8,9);/q;+1 |
| InChIKey | TVJTZDVUEBDLQP-UHFFFAOYSA-N |
| XLogP | -2.24 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.11 |
| LogP ≤ 5 | -2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |