C9H10O2 — CID 88801051
ethene;2-hydroxycyclohepta-2,4,6-trien-1-one (PubChem CID 88801051) has the molecular formula C9H10O2 and a molecular weight of 150.18 g/mol. Its IUPAC name is ethene;2-hydroxycyclohepta-2,4,6-trien-1-one.
| Compound Name | ethene;2-hydroxycyclohepta-2,4,6-trien-1-one |
|---|---|
| PubChem CID | 88801051 |
| Molecular Formula | C9H10O2 |
| Molecular Weight | 150.18 g/mol |
| Exact Mass | 150.07 |
| IUPAC Name | ethene;2-hydroxycyclohepta-2,4,6-trien-1-one |
| SMILES | C=C.O=c1cccccc1O |
| InChI | InChI=1S/C7H6O2.C2H4/c8-6-4-2-1-3-5-7(6)9;1-2/h1-5H,(H,8,9);1-2H2 |
| InChIKey | XRTPHYSBNYSMCJ-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.18 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|