C14H10O5 — CID 159253818
cyclohepta-4,6-diene-1,2,3-trione;2-hydroxycyclohepta-2,4,6-trien-1-one (PubChem CID 159253818) has the molecular formula C14H10O5 and a molecular weight of 258.23 g/mol. Its IUPAC name is cyclohepta-4,6-diene-1,2,3-trione;2-hydroxycyclohepta-2,4,6-trien-1-one.
| Compound Name | cyclohepta-4,6-diene-1,2,3-trione;2-hydroxycyclohepta-2,4,6-trien-1-one |
|---|---|
| PubChem CID | 159253818 |
| Molecular Formula | C14H10O5 |
| Molecular Weight | 258.23 g/mol |
| Exact Mass | 258.05 |
| IUPAC Name | cyclohepta-4,6-diene-1,2,3-trione;2-hydroxycyclohepta-2,4,6-trien-1-one |
| SMILES | O=C1C=CC=CC(=O)C1=O.O=c1cccccc1O |
| InChI | InChI=1S/C7H4O3.C7H6O2/c8-5-3-1-2-4-6(9)7(5)10;8-6-4-2-1-3-5-7(6)9/h1-4H;1-5H,(H,8,9) |
| InChIKey | KVQDUCYDDLFWBO-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 88.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.23 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|