C12H8N2O2 — CID 90841907
3-phenyldiazenylcyclohexa-3,5-diene-1,2-dione (PubChem CID 90841907) has the molecular formula C12H8N2O2 and a molecular weight of 212.21 g/mol. Its IUPAC name is 3-phenyldiazenylcyclohexa-3,5-diene-1,2-dione.
| Compound Name | 3-phenyldiazenylcyclohexa-3,5-diene-1,2-dione |
|---|---|
| PubChem CID | 90841907 |
| Molecular Formula | C12H8N2O2 |
| Molecular Weight | 212.21 g/mol |
| Exact Mass | 212.06 |
| IUPAC Name | 3-phenyldiazenylcyclohexa-3,5-diene-1,2-dione |
| SMILES | O=C1C=CC=C(/N=N/c2ccccc2)C1=O |
| InChI | InChI=1S/C12H8N2O2/c15-11-8-4-7-10(12(11)16)14-13-9-5-2-1-3-6-9/h1-8H/b14-13+ |
| InChIKey | OEJWUDWDWPMBOS-BUHFOSPRSA-N |
| XLogP | 2.36 |
| TPSA | 58.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.21 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|