C7H6NiO2+2 — CID 23036585
2-hydroxycyclohepta-2,4,6-trien-1-one;nickel(2+) (PubChem CID 23036585) has the molecular formula C7H6NiO2+2 and a molecular weight of 180.82 g/mol. Its IUPAC name is 2-hydroxycyclohepta-2,4,6-trien-1-one;nickel(2+).
| Compound Name | 2-hydroxycyclohepta-2,4,6-trien-1-one;nickel(2+) |
|---|---|
| PubChem CID | 23036585 |
| Molecular Formula | C7H6NiO2+2 |
| Molecular Weight | 180.82 g/mol |
| Exact Mass | 179.97 |
| IUPAC Name | 2-hydroxycyclohepta-2,4,6-trien-1-one;nickel(2+) |
| SMILES | O=c1cccccc1O.[Ni+2] |
| InChI | InChI=1S/C7H6O2.Ni/c8-6-4-2-1-3-5-7(6)9;/h1-5H,(H,8,9);/q;+2 |
| InChIKey | WNEKPNLCGKUQAK-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.82 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |