C13H10O2 — CID 11019840
2-hydroxy-6-phenylcyclohepta-2,4,6-trien-1-one (PubChem CID 11019840) has the molecular formula C13H10O2 and a molecular weight of 198.22 g/mol. Its IUPAC name is 2-hydroxy-6-phenylcyclohepta-2,4,6-trien-1-one.
| Compound Name | 2-hydroxy-6-phenylcyclohepta-2,4,6-trien-1-one |
|---|---|
| PubChem CID | 11019840 |
| Molecular Formula | C13H10O2 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.07 |
| IUPAC Name | 2-hydroxy-6-phenylcyclohepta-2,4,6-trien-1-one |
| SMILES | O=c1cc(-c2ccccc2)cccc1O |
| InChI | InChI=1S/C13H10O2/c14-12-8-4-7-11(9-13(12)15)10-5-2-1-3-6-10/h1-9H,(H,14,15) |
| InChIKey | MAAPIYPCXMEMAV-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |