About chlorobenzene;chloroform;1,2-dichlorobenzene
chlorobenzene;chloroform;1,2-dichlorobenzene (PubChem CID 159790050) has the molecular formula C13H10Cl6
and a molecular weight of 378.94 g/mol. Its IUPAC name is chlorobenzene;chloroform;1,2-dichlorobenzene.
Molecular Properties
| Compound Name | chlorobenzene;chloroform;1,2-dichlorobenzene |
| PubChem CID | 159790050 |
| Molecular Formula | C13H10Cl6 |
| Molecular Weight | 378.94 g/mol |
| Exact Mass | 375.89 |
| IUPAC Name | chlorobenzene;chloroform;1,2-dichlorobenzene |
| SMILES | ClC(Cl)Cl.Clc1ccccc1.Clc1ccccc1Cl |
| InChI | InChI=1S/C6H4Cl2.C6H5Cl.CHCl3/c7-5-3-1-2-4-6(5)8;7-6-4-2-1-3-5-6;2-1(3)4/h1-4H;1-5H;1H |
| InChIKey | NILFMTJUXZVDKZ-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 378.94 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze chlorobenzene;chloroform;1,2-dichlorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chlorobenzene;chloroform;1,2-dichlorobenzene?
The IUPAC name of chlorobenzene;chloroform;1,2-dichlorobenzene (CID 159790050) is chlorobenzene;chloroform;1,2-dichlorobenzene.
What is the SMILES notation for chlorobenzene;chloroform;1,2-dichlorobenzene?
The canonical SMILES for chlorobenzene;chloroform;1,2-dichlorobenzene is ClC(Cl)Cl.Clc1ccccc1.Clc1ccccc1Cl.
What is the InChIKey of chlorobenzene;chloroform;1,2-dichlorobenzene?
The InChIKey is NILFMTJUXZVDKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4Cl2.C6H5Cl.CHCl3/c7-5-3-1-2-4-6(5)8;7-6-4-2-1-3-5-6;2-1(3)4/h1-4H;1-5H;1H.
What are the key properties of chlorobenzene;chloroform;1,2-dichlorobenzene?
chlorobenzene;chloroform;1,2-dichlorobenzene has a molecular weight of 378.94 g/mol, XLogP of 7.32, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for chlorobenzene;chloroform;1,2-dichlorobenzene is sourced from PubChem (CID 159790050), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).