C16H20O3 — CID 160621546
4-tert-butylbenzene-1,2-diol;phenol (PubChem CID 160621546) has the molecular formula C16H20O3 and a molecular weight of 260.33 g/mol. Its IUPAC name is 4-tert-butylbenzene-1,2-diol;phenol.
| Compound Name | 4-tert-butylbenzene-1,2-diol;phenol |
|---|---|
| PubChem CID | 160621546 |
| Molecular Formula | C16H20O3 |
| Molecular Weight | 260.33 g/mol |
| Exact Mass | 260.14 |
| IUPAC Name | 4-tert-butylbenzene-1,2-diol;phenol |
| SMILES | CC(C)(C)c1ccc(O)c(O)c1.Oc1ccccc1 |
| InChI | InChI=1S/C10H14O2.C6H6O/c1-10(2,3)7-4-5-8(11)9(12)6-7;7-6-4-2-1-3-5-6/h4-6,11-12H,1-3H3;1-5,7H |
| InChIKey | RGTOGUMWFZTIGG-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.33 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|