C20H28O4 — CID 19086682
benzene-1,3-diol;4-(2,4,4-trimethylpentan-2-yl)benzene-1,2-diol (PubChem CID 19086682) has the molecular formula C20H28O4 and a molecular weight of 332.44 g/mol. Its IUPAC name is benzene-1,3-diol;4-(2,4,4-trimethylpentan-2-yl)benzene-1,2-diol.
| Compound Name | benzene-1,3-diol;4-(2,4,4-trimethylpentan-2-yl)benzene-1,2-diol |
|---|---|
| PubChem CID | 19086682 |
| Molecular Formula | C20H28O4 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | benzene-1,3-diol;4-(2,4,4-trimethylpentan-2-yl)benzene-1,2-diol |
| SMILES | CC(C)(C)CC(C)(C)c1ccc(O)c(O)c1.Oc1cccc(O)c1 |
| InChI | InChI=1S/C14H22O2.C6H6O2/c1-13(2,3)9-14(4,5)10-6-7-11(15)12(16)8-10;7-5-2-1-3-6(8)4-5/h6-8,15-16H,9H2,1-5H3;1-4,7-8H |
| InChIKey | UJEAUFCNCXUFGZ-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|