C24H34O — CID 159896343
2-(3-tert-butylphenyl)-4-(2,4,4-trimethylpentan-2-yl)phenol (PubChem CID 159896343) has the molecular formula C24H34O and a molecular weight of 338.54 g/mol. Its IUPAC name is 2-(3-tert-butylphenyl)-4-(2,4,4-trimethylpentan-2-yl)phenol.
| Compound Name | 2-(3-tert-butylphenyl)-4-(2,4,4-trimethylpentan-2-yl)phenol |
|---|---|
| PubChem CID | 159896343 |
| Molecular Formula | C24H34O |
| Molecular Weight | 338.54 g/mol |
| Exact Mass | 338.26 |
| IUPAC Name | 2-(3-tert-butylphenyl)-4-(2,4,4-trimethylpentan-2-yl)phenol |
| SMILES | CC(C)(C)CC(C)(C)c1ccc(O)c(-c2cccc(C(C)(C)C)c2)c1 |
| InChI | InChI=1S/C24H34O/c1-22(2,3)16-24(7,8)19-12-13-21(25)20(15-19)17-10-9-11-18(14-17)23(4,5)6/h9-15,25H,16H2,1-8H3 |
| InChIKey | NVJUVEFCINCDNH-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.54 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |