C15H16OP+ — CID 154152930
1,1-diphenylpropyl(oxo)phosphanium (PubChem CID 154152930) has the molecular formula C15H16OP+ and a molecular weight of 243.27 g/mol. Its IUPAC name is 1,1-diphenylpropyl(oxo)phosphanium.
| Compound Name | 1,1-diphenylpropyl(oxo)phosphanium |
|---|---|
| PubChem CID | 154152930 |
| Molecular Formula | C15H16OP+ |
| Molecular Weight | 243.27 g/mol |
| Exact Mass | 243.09 |
| IUPAC Name | 1,1-diphenylpropyl(oxo)phosphanium |
| SMILES | CCC([PH+]=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C15H15OP/c1-2-15(17-16,13-9-5-3-6-10-13)14-11-7-4-8-12-14/h3-12H,2H2,1H3/p+1 |
| InChIKey | AEDHGZJVQLVOIQ-UHFFFAOYSA-O |
| XLogP | 4.36 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.27 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|