About dihydroxy(dioxo)chromium;phthalaldehyde
dihydroxy(dioxo)chromium;phthalaldehyde (PubChem CID 174903240) has the molecular formula C8H8CrO6
and a molecular weight of 252.14 g/mol. Its IUPAC name is dihydroxy(dioxo)chromium;phthalaldehyde.
Molecular Properties
| Compound Name | dihydroxy(dioxo)chromium;phthalaldehyde |
| PubChem CID | 174903240 |
| Molecular Formula | C8H8CrO6 |
| Molecular Weight | 252.14 g/mol |
| Exact Mass | 251.97 |
| IUPAC Name | dihydroxy(dioxo)chromium;phthalaldehyde |
| SMILES | O=Cc1ccccc1C=O.O=[Cr](=O)(O)O |
| InChI | InChI=1S/C8H6O2.Cr.2H2O.2O/c9-5-7-3-1-2-4-8(7)6-10;;;;;/h1-6H;;2*1H2;;/q;+2;;;;/p-2 |
| InChIKey | VIHYDZGMPRYNHY-UHFFFAOYSA-L |
| XLogP | -0.04 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.14 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze dihydroxy(dioxo)chromium;phthalaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dihydroxy(dioxo)chromium;phthalaldehyde?
The IUPAC name of dihydroxy(dioxo)chromium;phthalaldehyde (CID 174903240) is dihydroxy(dioxo)chromium;phthalaldehyde.
What is the SMILES notation for dihydroxy(dioxo)chromium;phthalaldehyde?
The canonical SMILES for dihydroxy(dioxo)chromium;phthalaldehyde is O=Cc1ccccc1C=O.O=[Cr](=O)(O)O.
What is the InChIKey of dihydroxy(dioxo)chromium;phthalaldehyde?
The InChIKey is VIHYDZGMPRYNHY-UHFFFAOYSA-L. The full InChI is InChI=1S/C8H6O2.Cr.2H2O.2O/c9-5-7-3-1-2-4-8(7)6-10;;;;;/h1-6H;;2*1H2;;/q;+2;;;;/p-2.
What are the key properties of dihydroxy(dioxo)chromium;phthalaldehyde?
dihydroxy(dioxo)chromium;phthalaldehyde has a molecular weight of 252.14 g/mol, XLogP of -0.04, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dihydroxy(dioxo)chromium;phthalaldehyde is sourced from PubChem (CID 174903240), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).