About bromo(diphenyl)silane
bromo(diphenyl)silane (PubChem CID 102303968) has the molecular formula C12H11BrSi
and a molecular weight of 263.21 g/mol. Its IUPAC name is bromo(diphenyl)silane.
Molecular Properties
| Compound Name | bromo(diphenyl)silane |
| PubChem CID | 102303968 |
| Molecular Formula | C12H11BrSi |
| Molecular Weight | 263.21 g/mol |
| Exact Mass | 261.98 |
| IUPAC Name | bromo(diphenyl)silane |
| SMILES | Br[SiH](c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C12H11BrSi/c13-14(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10,14H |
| InChIKey | OPNUPWSUWQHIKG-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.21 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|
Analyze bromo(diphenyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bromo(diphenyl)silane?
The IUPAC name of bromo(diphenyl)silane (CID 102303968) is bromo(diphenyl)silane.
What is the SMILES notation for bromo(diphenyl)silane?
The canonical SMILES for bromo(diphenyl)silane is Br[SiH](c1ccccc1)c1ccccc1.
What is the InChIKey of bromo(diphenyl)silane?
The InChIKey is OPNUPWSUWQHIKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11BrSi/c13-14(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10,14H.
What are the key properties of bromo(diphenyl)silane?
bromo(diphenyl)silane has a molecular weight of 263.21 g/mol, XLogP of 1.92, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for bromo(diphenyl)silane is sourced from PubChem (CID 102303968), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).