About buta-2,3-dien-2-yl(diphenyl)silane
buta-2,3-dien-2-yl(diphenyl)silane (PubChem CID 164685826) has the molecular formula C16H16Si
and a molecular weight of 236.39 g/mol. Its IUPAC name is buta-2,3-dien-2-yl(diphenyl)silane.
Molecular Properties
| Compound Name | buta-2,3-dien-2-yl(diphenyl)silane |
| PubChem CID | 164685826 |
| Molecular Formula | C16H16Si |
| Molecular Weight | 236.39 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | buta-2,3-dien-2-yl(diphenyl)silane |
| SMILES | C=C=C(C)[SiH](c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C16H16Si/c1-3-14(2)17(15-10-6-4-7-11-15)16-12-8-5-9-13-16/h4-13,17H,1H2,2H3 |
| InChIKey | XHUCCBHCZZZTNL-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.39 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze buta-2,3-dien-2-yl(diphenyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of buta-2,3-dien-2-yl(diphenyl)silane?
The IUPAC name of buta-2,3-dien-2-yl(diphenyl)silane (CID 164685826) is buta-2,3-dien-2-yl(diphenyl)silane.
What is the SMILES notation for buta-2,3-dien-2-yl(diphenyl)silane?
The canonical SMILES for buta-2,3-dien-2-yl(diphenyl)silane is C=C=C(C)[SiH](c1ccccc1)c1ccccc1.
What is the InChIKey of buta-2,3-dien-2-yl(diphenyl)silane?
The InChIKey is XHUCCBHCZZZTNL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16Si/c1-3-14(2)17(15-10-6-4-7-11-15)16-12-8-5-9-13-16/h4-13,17H,1H2,2H3.
What are the key properties of buta-2,3-dien-2-yl(diphenyl)silane?
buta-2,3-dien-2-yl(diphenyl)silane has a molecular weight of 236.39 g/mol, XLogP of 2.30, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for buta-2,3-dien-2-yl(diphenyl)silane is sourced from PubChem (CID 164685826), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).