C16H14 — CID 177461787
1-buta-2,3-dien-2-yl-2-phenylbenzene (PubChem CID 177461787) has the molecular formula C16H14 and a molecular weight of 206.29 g/mol. Its IUPAC name is 1-buta-2,3-dien-2-yl-2-phenylbenzene.
| Compound Name | 1-buta-2,3-dien-2-yl-2-phenylbenzene |
|---|---|
| PubChem CID | 177461787 |
| Molecular Formula | C16H14 |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | 1-buta-2,3-dien-2-yl-2-phenylbenzene |
| SMILES | C=C=C(C)c1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C16H14/c1-3-13(2)15-11-7-8-12-16(15)14-9-5-4-6-10-14/h4-12H,1H2,2H3 |
| InChIKey | FWIMVPKSIYPCDH-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |