C10H9Cl — CID 154718725
1-buta-2,3-dien-2-yl-2-chlorobenzene (PubChem CID 154718725) has the molecular formula C10H9Cl and a molecular weight of 164.63 g/mol. Its IUPAC name is 1-buta-2,3-dien-2-yl-2-chlorobenzene.
| Compound Name | 1-buta-2,3-dien-2-yl-2-chlorobenzene |
|---|---|
| PubChem CID | 154718725 |
| Molecular Formula | C10H9Cl |
| Molecular Weight | 164.63 g/mol |
| Exact Mass | 164.04 |
| IUPAC Name | 1-buta-2,3-dien-2-yl-2-chlorobenzene |
| SMILES | C=C=C(C)c1ccccc1Cl |
| InChI | InChI=1S/C10H9Cl/c1-3-8(2)9-6-4-5-7-10(9)11/h4-7H,1H2,2H3 |
| InChIKey | HNMSDIRCBZRAMM-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.63 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |